C29H35F2N7O3Si — CID 178122499
N-[5-[6-(4,4-difluoropiperidin-1-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-8-oxo-7-(2-trimethylsilylethoxymethyl)-2,7-naphthyridin-3-yl]cyclopropanecarboxamide (PubChem CID 178122499) has the molecular formula C29H35F2N7O3Si and a molecular weight of 595.73 g/mol. Its IUPAC name is N-[5-[6-(4,4-difluoropiperidin-1-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-8-oxo-7-(2-trimethylsilylethoxymethyl)-2,7-naphthyridin-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[5-[6-(4,4-difluoropiperidin-1-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-8-oxo-7-(2-trimethylsilylethoxymethyl)-2,7-naphthyridin-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 178122499 |
| Molecular Formula | C29H35F2N7O3Si |
| Molecular Weight | 595.73 g/mol |
| Exact Mass | 595.25 |
| IUPAC Name | N-[5-[6-(4,4-difluoropiperidin-1-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-8-oxo-7-(2-trimethylsilylethoxymethyl)-2,7-naphthyridin-3-yl]cyclopropanecarboxamide |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2nc3ccc(N4CCC(F)(F)CC4)cn3n2)c2cc(NC(=O)C3CC3)ncc2c1=O |
| InChI | InChI=1S/C29H35F2N7O3Si/c1-42(2,3)13-12-41-18-37-17-23(21-14-24(32-15-22(21)28(37)40)33-27(39)19-4-5-19)26-34-25-7-6-20(16-38(25)35-26)36-10-8-29(30,31)9-11-36/h6-7,14-17,19H,4-5,8-13,18H2,1-3H3,(H,32,33,39) |
| InChIKey | MOPNCQFMHFFNFV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 106.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.73 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|