C30H40N8O3Si — CID 178122938
N-[5-[6-[(3S)-3,4-dimethylpiperazin-1-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-8-oxo-7-(2-trimethylsilylethoxymethyl)-2,7-naphthyridin-3-yl]cyclopropanecarboxamide (PubChem CID 178122938) has the molecular formula C30H40N8O3Si and a molecular weight of 588.79 g/mol. Its IUPAC name is N-[5-[6-[(3S)-3,4-dimethylpiperazin-1-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-8-oxo-7-(2-trimethylsilylethoxymethyl)-2,7-naphthyridin-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[5-[6-[(3S)-3,4-dimethylpiperazin-1-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-8-oxo-7-(2-trimethylsilylethoxymethyl)-2,7-naphthyridin-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 178122938 |
| Molecular Formula | C30H40N8O3Si |
| Molecular Weight | 588.79 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | N-[5-[6-[(3S)-3,4-dimethylpiperazin-1-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-8-oxo-7-(2-trimethylsilylethoxymethyl)-2,7-naphthyridin-3-yl]cyclopropanecarboxamide |
| SMILES | C[C@H]1CN(c2ccc3nc(-c4cn(COCC[Si](C)(C)C)c(=O)c5cnc(NC(=O)C6CC6)cc45)nn3c2)CCN1C |
| InChI | InChI=1S/C30H40N8O3Si/c1-20-16-36(11-10-35(20)2)22-8-9-27-33-28(34-38(27)17-22)25-18-37(19-41-12-13-42(3,4)5)30(40)24-15-31-26(14-23(24)25)32-29(39)21-6-7-21/h8-9,14-15,17-18,20-21H,6-7,10-13,16,19H2,1-5H3,(H,31,32,39)/t20-/m0/s1 |
| InChIKey | XCVQJJBGORTLOT-FQEVSTJZSA-N |
| XLogP | 3.91 |
| TPSA | 109.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.79 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|