C18H25N3O3Si — CID 178122976
N-[8-oxo-7-(2-trimethylsilylethoxymethyl)-2,7-naphthyridin-3-yl]cyclopropanecarboxamide (PubChem CID 178122976) has the molecular formula C18H25N3O3Si and a molecular weight of 359.50 g/mol. Its IUPAC name is N-[8-oxo-7-(2-trimethylsilylethoxymethyl)-2,7-naphthyridin-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[8-oxo-7-(2-trimethylsilylethoxymethyl)-2,7-naphthyridin-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 178122976 |
| Molecular Formula | C18H25N3O3Si |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-[8-oxo-7-(2-trimethylsilylethoxymethyl)-2,7-naphthyridin-3-yl]cyclopropanecarboxamide |
| SMILES | C[Si](C)(C)CCOCn1ccc2cc(NC(=O)C3CC3)ncc2c1=O |
| InChI | InChI=1S/C18H25N3O3Si/c1-25(2,3)9-8-24-12-21-7-6-14-10-16(19-11-15(14)18(21)23)20-17(22)13-4-5-13/h6-7,10-11,13H,4-5,8-9,12H2,1-3H3,(H,19,20,22) |
| InChIKey | IDHCEWGWUWAEEZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|