C28H38N2O2Si — CID 153301425
6-[(4-cyclohexylphenyl)methylamino]-2-(2-trimethylsilylethoxymethyl)isoquinolin-1-one (PubChem CID 153301425) has the molecular formula C28H38N2O2Si and a molecular weight of 462.71 g/mol. Its IUPAC name is 6-[(4-cyclohexylphenyl)methylamino]-2-(2-trimethylsilylethoxymethyl)isoquinolin-1-one.
| Compound Name | 6-[(4-cyclohexylphenyl)methylamino]-2-(2-trimethylsilylethoxymethyl)isoquinolin-1-one |
|---|---|
| PubChem CID | 153301425 |
| Molecular Formula | C28H38N2O2Si |
| Molecular Weight | 462.71 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | 6-[(4-cyclohexylphenyl)methylamino]-2-(2-trimethylsilylethoxymethyl)isoquinolin-1-one |
| SMILES | C[Si](C)(C)CCOCn1ccc2cc(NCc3ccc(C4CCCCC4)cc3)ccc2c1=O |
| InChI | InChI=1S/C28H38N2O2Si/c1-33(2,3)18-17-32-21-30-16-15-25-19-26(13-14-27(25)28(30)31)29-20-22-9-11-24(12-10-22)23-7-5-4-6-8-23/h9-16,19,23,29H,4-8,17-18,20-21H2,1-3H3 |
| InChIKey | KWHKUAFLEDIWHZ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.71 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|