C20H22ClNO2 — CID 135241315
2-chloro-4-[(4-cyclohexylphenyl)methylamino]benzoic acid (PubChem CID 135241315) has the molecular formula C20H22ClNO2 and a molecular weight of 343.85 g/mol. Its IUPAC name is 2-chloro-4-[(4-cyclohexylphenyl)methylamino]benzoic acid.
| Compound Name | 2-chloro-4-[(4-cyclohexylphenyl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 135241315 |
| Molecular Formula | C20H22ClNO2 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 2-chloro-4-[(4-cyclohexylphenyl)methylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NCc2ccc(C3CCCCC3)cc2)cc1Cl |
| InChI | InChI=1S/C20H22ClNO2/c21-19-12-17(10-11-18(19)20(23)24)22-13-14-6-8-16(9-7-14)15-4-2-1-3-5-15/h6-12,15,22H,1-5,13H2,(H,23,24) |
| InChIKey | KUOPMRAFOISUQF-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |