2-chloro-4-[(4-cyclohexylphenyl)methylamino]benzoic acid

C20H22ClNO2 — CID 135241315

IUPAC2-chloro-4-[(4-cyclohexylphenyl)methylamino]benzoic acid
SMILESO=C(O)c1ccc(NCc2ccc(C3CCCCC3)cc2)cc1Cl
InChIInChI=1S/C20H22ClNO2/c21-19-12-17(10-11-18(19)20(23)24)22-13-14-6-8-16(9-7-14)15-4-2-1-3-5-15/h6-12,15,22H,1-5,13H2,(H,23,24)
InChIKeyKUOPMRAFOISUQF-UHFFFAOYSA-N
MW343.85 g/mol
LogP5.70
Rot. Bonds5

About 2-chloro-4-[(4-cyclohexylphenyl)methylamino]benzoic acid

2-chloro-4-[(4-cyclohexylphenyl)methylamino]benzoic acid (PubChem CID 135241315) has the molecular formula C20H22ClNO2 and a molecular weight of 343.85 g/mol. Its IUPAC name is 2-chloro-4-[(4-cyclohexylphenyl)methylamino]benzoic acid.

Molecular Properties

Compound Name2-chloro-4-[(4-cyclohexylphenyl)methylamino]benzoic acid
PubChem CID135241315
Molecular FormulaC20H22ClNO2
Molecular Weight343.85 g/mol
Exact Mass343.13
IUPAC Name2-chloro-4-[(4-cyclohexylphenyl)methylamino]benzoic acid
SMILESO=C(O)c1ccc(NCc2ccc(C3CCCCC3)cc2)cc1Cl
InChIInChI=1S/C20H22ClNO2/c21-19-12-17(10-11-18(19)20(23)24)22-13-14-6-8-16(9-7-14)15-4-2-1-3-5-15/h6-12,15,22H,1-5,13H2,(H,23,24)
InChIKeyKUOPMRAFOISUQF-UHFFFAOYSA-N
XLogP5.70
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500343.85
LogP ≤ 55.70
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-chloro-4-[(4-cyclohexylphenyl)methylamino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-chloro-4-[(4-cyclohexylphenyl)methylamino]benzoic acid?
The IUPAC name of 2-chloro-4-[(4-cyclohexylphenyl)methylamino]benzoic acid (CID 135241315) is 2-chloro-4-[(4-cyclohexylphenyl)methylamino]benzoic acid.
What is the SMILES notation for 2-chloro-4-[(4-cyclohexylphenyl)methylamino]benzoic acid?
The canonical SMILES for 2-chloro-4-[(4-cyclohexylphenyl)methylamino]benzoic acid is O=C(O)c1ccc(NCc2ccc(C3CCCCC3)cc2)cc1Cl.
What is the InChIKey of 2-chloro-4-[(4-cyclohexylphenyl)methylamino]benzoic acid?
The InChIKey is KUOPMRAFOISUQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22ClNO2/c21-19-12-17(10-11-18(19)20(23)24)22-13-14-6-8-16(9-7-14)15-4-2-1-3-5-15/h6-12,15,22H,1-5,13H2,(H,23,24).
What are the key properties of 2-chloro-4-[(4-cyclohexylphenyl)methylamino]benzoic acid?
2-chloro-4-[(4-cyclohexylphenyl)methylamino]benzoic acid has a molecular weight of 343.85 g/mol, XLogP of 5.70, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-[(4-cyclohexylphenyl)methylamino]benzoic acid is sourced from PubChem (CID 135241315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).