C19H32N4OSi — CID 141355610
N-[[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]methyl]cyclohexanamine (PubChem CID 141355610) has the molecular formula C19H32N4OSi and a molecular weight of 360.58 g/mol. Its IUPAC name is N-[[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]methyl]cyclohexanamine.
| Compound Name | N-[[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]methyl]cyclohexanamine |
|---|---|
| PubChem CID | 141355610 |
| Molecular Formula | C19H32N4OSi |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | N-[[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]methyl]cyclohexanamine |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(CNC3CCCCC3)ncnc21 |
| InChI | InChI=1S/C19H32N4OSi/c1-25(2,3)12-11-24-15-23-10-9-17-18(21-14-22-19(17)23)13-20-16-7-5-4-6-8-16/h9-10,14,16,20H,4-8,11-13,15H2,1-3H3 |
| InChIKey | OOFQBRUDMBVMRM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|