C24H35N5OSi — CID 58177295
N-cyclohexyl-6-methyl-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]pyridin-2-amine (PubChem CID 58177295) has the molecular formula C24H35N5OSi and a molecular weight of 437.66 g/mol. Its IUPAC name is N-cyclohexyl-6-methyl-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]pyridin-2-amine.
| Compound Name | N-cyclohexyl-6-methyl-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 58177295 |
| Molecular Formula | C24H35N5OSi |
| Molecular Weight | 437.66 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | N-cyclohexyl-6-methyl-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]pyridin-2-amine |
| SMILES | Cc1ccc(-c2cnc3c(ccn3COCC[Si](C)(C)C)n2)c(NC2CCCCC2)n1 |
| InChI | InChI=1S/C24H35N5OSi/c1-18-10-11-20(23(26-18)27-19-8-6-5-7-9-19)22-16-25-24-21(28-22)12-13-29(24)17-30-14-15-31(2,3)4/h10-13,16,19H,5-9,14-15,17H2,1-4H3,(H,26,27) |
| InChIKey | YNEFYEPCKIMRTB-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.66 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|