C24H33F3N6OSi — CID 123674189
5-[1-(2,2,2-trifluoroethyl)piperidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]pyridin-2-amine (PubChem CID 123674189) has the molecular formula C24H33F3N6OSi and a molecular weight of 506.65 g/mol. Its IUPAC name is 5-[1-(2,2,2-trifluoroethyl)piperidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]pyridin-2-amine.
| Compound Name | 5-[1-(2,2,2-trifluoroethyl)piperidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 123674189 |
| Molecular Formula | C24H33F3N6OSi |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | 5-[1-(2,2,2-trifluoroethyl)piperidin-3-yl]-3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]pyridin-2-amine |
| SMILES | C[Si](C)(C)CCOCn1ccc2nc(-c3cc(C4CCCN(CC(F)(F)F)C4)cnc3N)cnc21 |
| InChI | InChI=1S/C24H33F3N6OSi/c1-35(2,3)10-9-34-16-33-8-6-20-23(33)30-13-21(31-20)19-11-18(12-29-22(19)28)17-5-4-7-32(14-17)15-24(25,26)27/h6,8,11-13,17H,4-5,7,9-10,14-16H2,1-3H3,(H2,28,29) |
| InChIKey | WHTXXHQLQCNEQF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|