C24H33F3N4O3Si — CID 90336041
4-[10-oxo-11-(2,2,2-trifluoroethyl)-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl]cyclohexane-1-carbaldehyde (PubChem CID 90336041) has the molecular formula C24H33F3N4O3Si and a molecular weight of 510.63 g/mol. Its IUPAC name is 4-[10-oxo-11-(2,2,2-trifluoroethyl)-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl]cyclohexane-1-carbaldehyde.
| Compound Name | 4-[10-oxo-11-(2,2,2-trifluoroethyl)-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl]cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 90336041 |
| Molecular Formula | C24H33F3N4O3Si |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | 4-[10-oxo-11-(2,2,2-trifluoroethyl)-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl]cyclohexane-1-carbaldehyde |
| SMILES | C[Si](C)(C)CCOCn1ccc2c3c(cnc21)C(=O)N(CC(F)(F)F)CN3C1CCC(C=O)CC1 |
| InChI | InChI=1S/C24H33F3N4O3Si/c1-35(2,3)11-10-34-16-29-9-8-19-21-20(12-28-22(19)29)23(33)30(14-24(25,26)27)15-31(21)18-6-4-17(13-32)5-7-18/h8-9,12-13,17-18H,4-7,10-11,14-16H2,1-3H3 |
| InChIKey | QZBOPSRZRISWER-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|