C29H44F3N5O4Si — CID 90335904
tert-butyl N-[[4-[10-oxo-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl]cyclohexyl]methyl]-N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 90335904) has the molecular formula C29H44F3N5O4Si and a molecular weight of 611.78 g/mol. Its IUPAC name is tert-butyl N-[[4-[10-oxo-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl]cyclohexyl]methyl]-N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | tert-butyl N-[[4-[10-oxo-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl]cyclohexyl]methyl]-N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 90335904 |
| Molecular Formula | C29H44F3N5O4Si |
| Molecular Weight | 611.78 g/mol |
| Exact Mass | 611.31 |
| IUPAC Name | tert-butyl N-[[4-[10-oxo-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl]cyclohexyl]methyl]-N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CC1CCC(N2CNC(=O)c3cnc4c(ccn4COCC[Si](C)(C)C)c32)CC1)CC(F)(F)F |
| InChI | InChI=1S/C29H44F3N5O4Si/c1-28(2,3)41-27(39)36(17-29(30,31)32)16-20-7-9-21(10-8-20)37-18-34-26(38)23-15-33-25-22(24(23)37)11-12-35(25)19-40-13-14-42(4,5)6/h11-12,15,20-21H,7-10,13-14,16-19H2,1-6H3,(H,34,38) |
| InChIKey | LEBPIQQLFLWNIZ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.78 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|