C23H34N4O2Si — CID 140773229
1-[4-(aminomethyl)cyclohexyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-4-one (PubChem CID 140773229) has the molecular formula C23H34N4O2Si and a molecular weight of 426.64 g/mol. Its IUPAC name is 1-[4-(aminomethyl)cyclohexyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-4-one.
| Compound Name | 1-[4-(aminomethyl)cyclohexyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-4-one |
|---|---|
| PubChem CID | 140773229 |
| Molecular Formula | C23H34N4O2Si |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 1-[4-(aminomethyl)cyclohexyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-4-one |
| SMILES | C[Si](C)(C)CCOCn1ccc2c1ncc1c(=O)ccn(C3CCC(CN)CC3)c12 |
| InChI | InChI=1S/C23H34N4O2Si/c1-30(2,3)13-12-29-16-26-10-8-19-22-20(15-25-23(19)26)21(28)9-11-27(22)18-6-4-17(14-24)5-7-18/h8-11,15,17-18H,4-7,12-14,16,24H2,1-3H3 |
| InChIKey | MNGWENFIQOODCL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|