C28H38N4O4Si — CID 151578016
4,5-dimethoxy-9-(1-methylpiperidin-4-yl)-14-(2-trimethylsilylethoxymethyl)-9,14,16-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2,4,6,10,12,15-heptaen-8-one (PubChem CID 151578016) has the molecular formula C28H38N4O4Si and a molecular weight of 522.72 g/mol. Its IUPAC name is 4,5-dimethoxy-9-(1-methylpiperidin-4-yl)-14-(2-trimethylsilylethoxymethyl)-9,14,16-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2,4,6,10,12,15-heptaen-8-one.
| Compound Name | 4,5-dimethoxy-9-(1-methylpiperidin-4-yl)-14-(2-trimethylsilylethoxymethyl)-9,14,16-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2,4,6,10,12,15-heptaen-8-one |
|---|---|
| PubChem CID | 151578016 |
| Molecular Formula | C28H38N4O4Si |
| Molecular Weight | 522.72 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | 4,5-dimethoxy-9-(1-methylpiperidin-4-yl)-14-(2-trimethylsilylethoxymethyl)-9,14,16-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2,4,6,10,12,15-heptaen-8-one |
| SMILES | COc1cc2c(=O)n(C3CCN(C)CC3)c3c(cnc4c3ccn4COCC[Si](C)(C)C)c2cc1OC |
| InChI | InChI=1S/C28H38N4O4Si/c1-30-10-7-19(8-11-30)32-26-20-9-12-31(18-36-13-14-37(4,5)6)27(20)29-17-23(26)21-15-24(34-2)25(35-3)16-22(21)28(32)33/h9,12,15-17,19H,7-8,10-11,13-14,18H2,1-6H3 |
| InChIKey | QFWMCGFXBJOJHO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 70.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.72 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|