C31H49F3N4O5Si2 — CID 140773219
13-[4-(3,3,3-trifluoropropoxymethyl)cyclohexyl]-5,11-bis(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-10,12-dione (PubChem CID 140773219) has the molecular formula C31H49F3N4O5Si2 and a molecular weight of 670.92 g/mol. Its IUPAC name is 13-[4-(3,3,3-trifluoropropoxymethyl)cyclohexyl]-5,11-bis(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-10,12-dione.
| Compound Name | 13-[4-(3,3,3-trifluoropropoxymethyl)cyclohexyl]-5,11-bis(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-10,12-dione |
|---|---|
| PubChem CID | 140773219 |
| Molecular Formula | C31H49F3N4O5Si2 |
| Molecular Weight | 670.92 g/mol |
| Exact Mass | 670.32 |
| IUPAC Name | 13-[4-(3,3,3-trifluoropropoxymethyl)cyclohexyl]-5,11-bis(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-10,12-dione |
| SMILES | C[Si](C)(C)CCOCn1c(=O)c2cnc3c(ccn3COCC[Si](C)(C)C)c2n(C2CCC(COCCC(F)(F)F)CC2)c1=O |
| InChI | InChI=1S/C31H49F3N4O5Si2/c1-44(2,3)17-15-42-21-36-13-11-25-27-26(19-35-28(25)36)29(39)37(22-43-16-18-45(4,5)6)30(40)38(27)24-9-7-23(8-10-24)20-41-14-12-31(32,33)34/h11,13,19,23-24H,7-10,12,14-18,20-22H2,1-6H3 |
| InChIKey | HOPLGTBFPPOHHG-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 89.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.92 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|