C23H34N4O4Si — CID 90336039
13-[4-[hydroxy(methoxy)methyl]cyclohexyl]-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8,11-pentaen-10-one (PubChem CID 90336039) has the molecular formula C23H34N4O4Si and a molecular weight of 458.64 g/mol. Its IUPAC name is 13-[4-[hydroxy(methoxy)methyl]cyclohexyl]-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8,11-pentaen-10-one.
| Compound Name | 13-[4-[hydroxy(methoxy)methyl]cyclohexyl]-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8,11-pentaen-10-one |
|---|---|
| PubChem CID | 90336039 |
| Molecular Formula | C23H34N4O4Si |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | 13-[4-[hydroxy(methoxy)methyl]cyclohexyl]-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8,11-pentaen-10-one |
| SMILES | COC(O)C1CCC(n2cnc(=O)c3cnc4c(ccn4COCC[Si](C)(C)C)c32)CC1 |
| InChI | InChI=1S/C23H34N4O4Si/c1-30-23(29)16-5-7-17(8-6-16)27-14-25-22(28)19-13-24-21-18(20(19)27)9-10-26(21)15-31-11-12-32(2,3)4/h9-10,13-14,16-17,23,29H,5-8,11-12,15H2,1-4H3 |
| InChIKey | FUVNTVFTTKBJFR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|