C29H37BrN4O2Si — CID 71264259
1-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-3-bromo-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-4-one (PubChem CID 71264259) has the molecular formula C29H37BrN4O2Si and a molecular weight of 581.63 g/mol. Its IUPAC name is 1-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-3-bromo-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-4-one.
| Compound Name | 1-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-3-bromo-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-4-one |
|---|---|
| PubChem CID | 71264259 |
| Molecular Formula | C29H37BrN4O2Si |
| Molecular Weight | 581.63 g/mol |
| Exact Mass | 580.19 |
| IUPAC Name | 1-[(3R,4R)-1-benzyl-4-methylpiperidin-3-yl]-3-bromo-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-4-one |
| SMILES | C[C@@H]1CCN(Cc2ccccc2)C[C@@H]1n1cc(Br)c(=O)c2cnc3c(ccn3COCC[Si](C)(C)C)c21 |
| InChI | InChI=1S/C29H37BrN4O2Si/c1-21-10-12-32(17-22-8-6-5-7-9-22)19-26(21)34-18-25(30)28(35)24-16-31-29-23(27(24)34)11-13-33(29)20-36-14-15-37(2,3)4/h5-9,11,13,16,18,21,26H,10,12,14-15,17,19-20H2,1-4H3/t21-,26+/m1/s1 |
| InChIKey | PGVDUBKNACWMGT-RLWLMLJZSA-N |
| XLogP | 6.51 |
| TPSA | 52.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.63 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|