C30H35F3N4O3Si — CID 123326967
1-[(3R,4R)-4-methyl-1-[4-(trifluoromethyl)benzoyl]piperidin-3-yl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-4-one (PubChem CID 123326967) has the molecular formula C30H35F3N4O3Si and a molecular weight of 584.72 g/mol. Its IUPAC name is 1-[(3R,4R)-4-methyl-1-[4-(trifluoromethyl)benzoyl]piperidin-3-yl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-4-one.
| Compound Name | 1-[(3R,4R)-4-methyl-1-[4-(trifluoromethyl)benzoyl]piperidin-3-yl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-4-one |
|---|---|
| PubChem CID | 123326967 |
| Molecular Formula | C30H35F3N4O3Si |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | 1-[(3R,4R)-4-methyl-1-[4-(trifluoromethyl)benzoyl]piperidin-3-yl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-4-one |
| SMILES | C[C@@H]1CCN(C(=O)c2ccc(C(F)(F)F)cc2)C[C@@H]1n1ccc(=O)c2cnc3c(ccn3COCC[Si](C)(C)C)c21 |
| InChI | InChI=1S/C30H35F3N4O3Si/c1-20-9-12-35(29(39)21-5-7-22(8-6-21)30(31,32)33)18-25(20)37-14-11-26(38)24-17-34-28-23(27(24)37)10-13-36(28)19-40-15-16-41(2,3)4/h5-8,10-11,13-14,17,20,25H,9,12,15-16,18-19H2,1-4H3/t20-,25+/m1/s1 |
| InChIKey | MXEFPEOTBLCGSW-NLFFAJNJSA-N |
| XLogP | 6.41 |
| TPSA | 69.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|