C25H41N3O3Si — CID 153397556
tert-butyl 4-[2-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]ethyl]piperidine-1-carboxylate (PubChem CID 153397556) has the molecular formula C25H41N3O3Si and a molecular weight of 459.71 g/mol. Its IUPAC name is tert-butyl 4-[2-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 153397556 |
| Molecular Formula | C25H41N3O3Si |
| Molecular Weight | 459.71 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | tert-butyl 4-[2-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCc2ccnc3c2ccn3COCC[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C25H41N3O3Si/c1-25(2,3)31-24(29)27-14-10-20(11-15-27)7-8-21-9-13-26-23-22(21)12-16-28(23)19-30-17-18-32(4,5)6/h9,12-13,16,20H,7-8,10-11,14-15,17-19H2,1-6H3 |
| InChIKey | RKTUNABPKMEAAE-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.71 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|