C27H41N7O4Si — CID 171795721
tert-butyl 4-[2-[[4-methoxy-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]-4-pyridinyl]piperazine-1-carboxylate (PubChem CID 171795721) has the molecular formula C27H41N7O4Si and a molecular weight of 555.76 g/mol. Its IUPAC name is tert-butyl 4-[2-[[4-methoxy-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]-4-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[4-methoxy-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]-4-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171795721 |
| Molecular Formula | C27H41N7O4Si |
| Molecular Weight | 555.76 g/mol |
| Exact Mass | 555.30 |
| IUPAC Name | tert-butyl 4-[2-[[4-methoxy-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]-4-pyridinyl]piperazine-1-carboxylate |
| SMILES | COc1nc(Nc2cc(N3CCN(C(=O)OC(C)(C)C)CC3)ccn2)nc2c1ccn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C27H41N7O4Si/c1-27(2,3)38-26(35)33-14-12-32(13-15-33)20-8-10-28-22(18-20)29-25-30-23-21(24(31-25)36-4)9-11-34(23)19-37-16-17-39(5,6)7/h8-11,18H,12-17,19H2,1-7H3,(H,28,29,30,31) |
| InChIKey | DKLGYUODUCENIY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.76 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|