C20H26ClN5O3 — CID 141427262
tert-butyl 4-[4-[(2-chloropyrimidin-4-yl)amino]-3-methoxyphenyl]piperazine-1-carboxylate (PubChem CID 141427262) has the molecular formula C20H26ClN5O3 and a molecular weight of 419.91 g/mol. Its IUPAC name is tert-butyl 4-[4-[(2-chloropyrimidin-4-yl)amino]-3-methoxyphenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(2-chloropyrimidin-4-yl)amino]-3-methoxyphenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 141427262 |
| Molecular Formula | C20H26ClN5O3 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | tert-butyl 4-[4-[(2-chloropyrimidin-4-yl)amino]-3-methoxyphenyl]piperazine-1-carboxylate |
| SMILES | COc1cc(N2CCN(C(=O)OC(C)(C)C)CC2)ccc1Nc1ccnc(Cl)n1 |
| InChI | InChI=1S/C20H26ClN5O3/c1-20(2,3)29-19(27)26-11-9-25(10-12-26)14-5-6-15(16(13-14)28-4)23-17-7-8-22-18(21)24-17/h5-8,13H,9-12H2,1-4H3,(H,22,23,24) |
| InChIKey | CTVDDJWSUCCYOM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |