C26H29ClN6O6 — CID 67128642
tert-butyl 4-[4-[[5-chloro-4-(3-nitrophenoxy)pyrimidin-2-yl]amino]-3-methoxyphenyl]piperazine-1-carboxylate (PubChem CID 67128642) has the molecular formula C26H29ClN6O6 and a molecular weight of 557.01 g/mol. Its IUPAC name is tert-butyl 4-[4-[[5-chloro-4-(3-nitrophenoxy)pyrimidin-2-yl]amino]-3-methoxyphenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[5-chloro-4-(3-nitrophenoxy)pyrimidin-2-yl]amino]-3-methoxyphenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 67128642 |
| Molecular Formula | C26H29ClN6O6 |
| Molecular Weight | 557.01 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | tert-butyl 4-[4-[[5-chloro-4-(3-nitrophenoxy)pyrimidin-2-yl]amino]-3-methoxyphenyl]piperazine-1-carboxylate |
| SMILES | COc1cc(N2CCN(C(=O)OC(C)(C)C)CC2)ccc1Nc1ncc(Cl)c(Oc2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C26H29ClN6O6/c1-26(2,3)39-25(34)32-12-10-31(11-13-32)17-8-9-21(22(15-17)37-4)29-24-28-16-20(27)23(30-24)38-19-7-5-6-18(14-19)33(35)36/h5-9,14-16H,10-13H2,1-4H3,(H,28,29,30) |
| InChIKey | ZCRKXEYSVBCIJS-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.01 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|