C24H25N7O4 — CID 58407962
N-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-4-(3-nitrophenoxy)pyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 58407962) has the molecular formula C24H25N7O4 and a molecular weight of 475.51 g/mol. Its IUPAC name is N-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-4-(3-nitrophenoxy)pyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | N-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-4-(3-nitrophenoxy)pyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 58407962 |
| Molecular Formula | C24H25N7O4 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | N-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-4-(3-nitrophenoxy)pyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | COc1cc(N2CCN(C)CC2)ccc1Nc1nc(Oc2cccc([N+](=O)[O-])c2)c2cccn2n1 |
| InChI | InChI=1S/C24H25N7O4/c1-28-11-13-29(14-12-28)17-8-9-20(22(16-17)34-2)25-24-26-23(21-7-4-10-30(21)27-24)35-19-6-3-5-18(15-19)31(32)33/h3-10,15-16H,11-14H2,1-2H3,(H,25,27) |
| InChIKey | OWJJPBYEPDJCQT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|