C22H25N7O5S — CID 162667856
methyl 3-[[2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-5-nitropyrimidin-4-yl]amino]thiophene-2-carboxylate (PubChem CID 162667856) has the molecular formula C22H25N7O5S and a molecular weight of 499.55 g/mol. Its IUPAC name is methyl 3-[[2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-5-nitropyrimidin-4-yl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-5-nitropyrimidin-4-yl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 162667856 |
| Molecular Formula | C22H25N7O5S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | methyl 3-[[2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-5-nitropyrimidin-4-yl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1Nc1nc(Nc2ccc(N3CCN(C)CC3)cc2OC)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H25N7O5S/c1-27-7-9-28(10-8-27)14-4-5-15(18(12-14)33-2)25-22-23-13-17(29(31)32)20(26-22)24-16-6-11-35-19(16)21(30)34-3/h4-6,11-13H,7-10H2,1-3H3,(H2,23,24,25,26) |
| InChIKey | VPAWZGXRVQMSKG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 134.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|