C25H30N8O7 — CID 175226389
[4-methoxy-3-[[5-methoxy-2-[2-methoxy-4-(4-methylpiperazin-1-yl)-5-nitroanilino]pyrimidin-4-yl]amino]phenyl] carbamate (PubChem CID 175226389) has the molecular formula C25H30N8O7 and a molecular weight of 554.56 g/mol. Its IUPAC name is [4-methoxy-3-[[5-methoxy-2-[2-methoxy-4-(4-methylpiperazin-1-yl)-5-nitroanilino]pyrimidin-4-yl]amino]phenyl] carbamate.
| Compound Name | [4-methoxy-3-[[5-methoxy-2-[2-methoxy-4-(4-methylpiperazin-1-yl)-5-nitroanilino]pyrimidin-4-yl]amino]phenyl] carbamate |
|---|---|
| PubChem CID | 175226389 |
| Molecular Formula | C25H30N8O7 |
| Molecular Weight | 554.56 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | [4-methoxy-3-[[5-methoxy-2-[2-methoxy-4-(4-methylpiperazin-1-yl)-5-nitroanilino]pyrimidin-4-yl]amino]phenyl] carbamate |
| SMILES | COc1cc(N2CCN(C)CC2)c([N+](=O)[O-])cc1Nc1ncc(OC)c(Nc2cc(OC(N)=O)ccc2OC)n1 |
| InChI | InChI=1S/C25H30N8O7/c1-31-7-9-32(10-8-31)18-13-21(38-3)17(12-19(18)33(35)36)29-25-27-14-22(39-4)23(30-25)28-16-11-15(40-24(26)34)5-6-20(16)37-2/h5-6,11-14H,7-10H2,1-4H3,(H2,26,34)(H2,27,28,29,30) |
| InChIKey | GMVYTHLQAVNSLE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 179.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|