C25H22ClN7O6 — CID 175225764
[3-[[2-[4-(azepin-1-yl)-2-methoxy-5-nitroanilino]-5-chloropyrimidin-4-yl]amino]-4-methoxyphenyl] carbamate (PubChem CID 175225764) has the molecular formula C25H22ClN7O6 and a molecular weight of 551.95 g/mol. Its IUPAC name is [3-[[2-[4-(azepin-1-yl)-2-methoxy-5-nitroanilino]-5-chloropyrimidin-4-yl]amino]-4-methoxyphenyl] carbamate.
| Compound Name | [3-[[2-[4-(azepin-1-yl)-2-methoxy-5-nitroanilino]-5-chloropyrimidin-4-yl]amino]-4-methoxyphenyl] carbamate |
|---|---|
| PubChem CID | 175225764 |
| Molecular Formula | C25H22ClN7O6 |
| Molecular Weight | 551.95 g/mol |
| Exact Mass | 551.13 |
| IUPAC Name | [3-[[2-[4-(azepin-1-yl)-2-methoxy-5-nitroanilino]-5-chloropyrimidin-4-yl]amino]-4-methoxyphenyl] carbamate |
| SMILES | COc1cc(N2C=CC=CC=C2)c([N+](=O)[O-])cc1Nc1ncc(Cl)c(Nc2cc(OC(N)=O)ccc2OC)n1 |
| InChI | InChI=1S/C25H22ClN7O6/c1-37-21-8-7-15(39-24(27)34)11-17(21)29-23-16(26)14-28-25(31-23)30-18-12-20(33(35)36)19(13-22(18)38-2)32-9-5-3-4-6-10-32/h3-14H,1-2H3,(H2,27,34)(H2,28,29,30,31) |
| InChIKey | OUIYCMBHCOJACD-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 167.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.95 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|