C25H28ClFN6O7S — CID 163289040
tert-butyl N-[3-[[5-chloro-2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]amino]-4-propan-2-ylsulfonylphenyl]carbamate (PubChem CID 163289040) has the molecular formula C25H28ClFN6O7S and a molecular weight of 611.05 g/mol. Its IUPAC name is tert-butyl N-[3-[[5-chloro-2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]amino]-4-propan-2-ylsulfonylphenyl]carbamate.
| Compound Name | tert-butyl N-[3-[[5-chloro-2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]amino]-4-propan-2-ylsulfonylphenyl]carbamate |
|---|---|
| PubChem CID | 163289040 |
| Molecular Formula | C25H28ClFN6O7S |
| Molecular Weight | 611.05 g/mol |
| Exact Mass | 610.14 |
| IUPAC Name | tert-butyl N-[3-[[5-chloro-2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]amino]-4-propan-2-ylsulfonylphenyl]carbamate |
| SMILES | COc1cc(F)c([N+](=O)[O-])cc1Nc1ncc(Cl)c(Nc2cc(NC(=O)OC(C)(C)C)ccc2S(=O)(=O)C(C)C)n1 |
| InChI | InChI=1S/C25H28ClFN6O7S/c1-13(2)41(37,38)21-8-7-14(29-24(34)40-25(3,4)5)9-18(21)30-22-15(26)12-28-23(32-22)31-17-11-19(33(35)36)16(27)10-20(17)39-6/h7-13H,1-6H3,(H,29,34)(H2,28,30,31,32) |
| InChIKey | OVRPDYNYVDOMAH-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 174.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.05 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|