C27H32ClN7O8S — CID 163289053
tert-butyl N-[3-[[5-chloro-2-(2-methoxy-4-morpholin-4-yl-5-nitroanilino)pyrimidin-4-yl]amino]-4-methylsulfonylphenyl]carbamate (PubChem CID 163289053) has the molecular formula C27H32ClN7O8S and a molecular weight of 650.11 g/mol. Its IUPAC name is tert-butyl N-[3-[[5-chloro-2-(2-methoxy-4-morpholin-4-yl-5-nitroanilino)pyrimidin-4-yl]amino]-4-methylsulfonylphenyl]carbamate.
| Compound Name | tert-butyl N-[3-[[5-chloro-2-(2-methoxy-4-morpholin-4-yl-5-nitroanilino)pyrimidin-4-yl]amino]-4-methylsulfonylphenyl]carbamate |
|---|---|
| PubChem CID | 163289053 |
| Molecular Formula | C27H32ClN7O8S |
| Molecular Weight | 650.11 g/mol |
| Exact Mass | 649.17 |
| IUPAC Name | tert-butyl N-[3-[[5-chloro-2-(2-methoxy-4-morpholin-4-yl-5-nitroanilino)pyrimidin-4-yl]amino]-4-methylsulfonylphenyl]carbamate |
| SMILES | COc1cc(N2CCOCC2)c([N+](=O)[O-])cc1Nc1ncc(Cl)c(Nc2cc(NC(=O)OC(C)(C)C)ccc2S(C)(=O)=O)n1 |
| InChI | InChI=1S/C27H32ClN7O8S/c1-27(2,3)43-26(36)30-16-6-7-23(44(5,39)40)19(12-16)31-24-17(28)15-29-25(33-24)32-18-13-21(35(37)38)20(14-22(18)41-4)34-8-10-42-11-9-34/h6-7,12-15H,8-11H2,1-5H3,(H,30,36)(H2,29,31,32,33) |
| InChIKey | UXACUBJDUKIPLH-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 187.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.11 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|