C23H24ClFN6O5S — CID 163289095
tert-butyl N-[3-[[5-chloro-2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]amino]-4-methylsulfanylphenyl]carbamate (PubChem CID 163289095) has the molecular formula C23H24ClFN6O5S and a molecular weight of 551.00 g/mol. Its IUPAC name is tert-butyl N-[3-[[5-chloro-2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]amino]-4-methylsulfanylphenyl]carbamate.
| Compound Name | tert-butyl N-[3-[[5-chloro-2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]amino]-4-methylsulfanylphenyl]carbamate |
|---|---|
| PubChem CID | 163289095 |
| Molecular Formula | C23H24ClFN6O5S |
| Molecular Weight | 551.00 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | tert-butyl N-[3-[[5-chloro-2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]amino]-4-methylsulfanylphenyl]carbamate |
| SMILES | COc1cc(F)c([N+](=O)[O-])cc1Nc1ncc(Cl)c(Nc2cc(NC(=O)OC(C)(C)C)ccc2SC)n1 |
| InChI | InChI=1S/C23H24ClFN6O5S/c1-23(2,3)36-22(32)27-12-6-7-19(37-5)16(8-12)28-20-13(24)11-26-21(30-20)29-15-10-17(31(33)34)14(25)9-18(15)35-4/h6-11H,1-5H3,(H,27,32)(H2,26,28,29,30) |
| InChIKey | RPMWRQKXSCHTIE-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 140.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.00 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|