C30H36ClN6O5P — CID 123137418
tert-butyl N-[1-[3-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyanilino]-3-oxoprop-1-enyl]cyclopropyl]carbamate (PubChem CID 123137418) has the molecular formula C30H36ClN6O5P and a molecular weight of 627.08 g/mol. Its IUPAC name is tert-butyl N-[1-[3-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyanilino]-3-oxoprop-1-enyl]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[1-[3-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyanilino]-3-oxoprop-1-enyl]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 123137418 |
| Molecular Formula | C30H36ClN6O5P |
| Molecular Weight | 627.08 g/mol |
| Exact Mass | 626.22 |
| IUPAC Name | tert-butyl N-[1-[3-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyanilino]-3-oxoprop-1-enyl]cyclopropyl]carbamate |
| SMILES | COc1ccc(NC(=O)C=CC2(NC(=O)OC(C)(C)C)CC2)cc1Nc1ncc(Cl)c(Nc2ccccc2P(C)(C)=O)n1 |
| InChI | InChI=1S/C30H36ClN6O5P/c1-29(2,3)42-28(39)37-30(15-16-30)14-13-25(38)33-19-11-12-23(41-4)22(17-19)35-27-32-18-20(31)26(36-27)34-21-9-7-8-10-24(21)43(5,6)40/h7-14,17-18H,15-16H2,1-6H3,(H,33,38)(H,37,39)(H2,32,34,35,36) |
| InChIKey | FINNZOXGXBFXQS-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 143.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.08 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|