C29H38ClN6O3P — CID 89156301
N-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]-2-[[di(propan-2-yl)amino]methyl]prop-2-enamide (PubChem CID 89156301) has the molecular formula C29H38ClN6O3P and a molecular weight of 585.09 g/mol. Its IUPAC name is N-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]-2-[[di(propan-2-yl)amino]methyl]prop-2-enamide.
| Compound Name | N-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]-2-[[di(propan-2-yl)amino]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 89156301 |
| Molecular Formula | C29H38ClN6O3P |
| Molecular Weight | 585.09 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | N-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]-2-[[di(propan-2-yl)amino]methyl]prop-2-enamide |
| SMILES | C=C(CN(C(C)C)C(C)C)C(=O)Nc1ccc(OC)c(Nc2ncc(Cl)c(Nc3ccccc3P(C)(C)=O)n2)c1 |
| InChI | InChI=1S/C29H38ClN6O3P/c1-18(2)36(19(3)4)17-20(5)28(37)32-21-13-14-25(39-6)24(15-21)34-29-31-16-22(30)27(35-29)33-23-11-9-10-12-26(23)40(7,8)38/h9-16,18-19H,5,17H2,1-4,6-8H3,(H,32,37)(H2,31,33,34,35) |
| InChIKey | RQMBPMFFGLJFMG-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.09 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|