C23H25ClN5O3P — CID 70977785
N-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]but-2-enamide (PubChem CID 70977785) has the molecular formula C23H25ClN5O3P and a molecular weight of 485.91 g/mol. Its IUPAC name is N-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]but-2-enamide.
| Compound Name | N-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]but-2-enamide |
|---|---|
| PubChem CID | 70977785 |
| Molecular Formula | C23H25ClN5O3P |
| Molecular Weight | 485.91 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | N-[3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]but-2-enamide |
| SMILES | CC=CC(=O)Nc1ccc(OC)c(Nc2ncc(Cl)c(Nc3ccccc3P(C)(C)=O)n2)c1 |
| InChI | InChI=1S/C23H25ClN5O3P/c1-5-8-21(30)26-15-11-12-19(32-2)18(13-15)28-23-25-14-16(24)22(29-23)27-17-9-6-7-10-20(17)33(3,4)31/h5-14H,1-4H3,(H,26,30)(H2,25,27,28,29) |
| InChIKey | OWEWEHBHVQGTDF-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.91 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|