C26H24ClN5O2 — CID 131969691
(E)-N-[3-[[5-chloro-4-[methyl(naphthalen-2-yl)amino]pyrimidin-2-yl]amino]-4-methoxyphenyl]but-2-enamide (PubChem CID 131969691) has the molecular formula C26H24ClN5O2 and a molecular weight of 473.96 g/mol. Its IUPAC name is (E)-N-[3-[[5-chloro-4-[methyl(naphthalen-2-yl)amino]pyrimidin-2-yl]amino]-4-methoxyphenyl]but-2-enamide.
| Compound Name | (E)-N-[3-[[5-chloro-4-[methyl(naphthalen-2-yl)amino]pyrimidin-2-yl]amino]-4-methoxyphenyl]but-2-enamide |
|---|---|
| PubChem CID | 131969691 |
| Molecular Formula | C26H24ClN5O2 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | (E)-N-[3-[[5-chloro-4-[methyl(naphthalen-2-yl)amino]pyrimidin-2-yl]amino]-4-methoxyphenyl]but-2-enamide |
| SMILES | C/C=C/C(=O)Nc1ccc(OC)c(Nc2ncc(Cl)c(N(C)c3ccc4ccccc4c3)n2)c1 |
| InChI | InChI=1S/C26H24ClN5O2/c1-4-7-24(33)29-19-11-13-23(34-3)22(15-19)30-26-28-16-21(27)25(31-26)32(2)20-12-10-17-8-5-6-9-18(17)14-20/h4-16H,1-3H3,(H,29,33)(H,28,30,31)/b7-4+ |
| InChIKey | KEMBIVVIZGCXLG-QPJJXVBHSA-N |
| XLogP | 6.32 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|