C26H31ClN6O3 — CID 146246575
N-[3-[[5-chloro-4-[4-[2-(dimethylamino)ethoxy]-2-ethylanilino]pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide (PubChem CID 146246575) has the molecular formula C26H31ClN6O3 and a molecular weight of 511.03 g/mol. Its IUPAC name is N-[3-[[5-chloro-4-[4-[2-(dimethylamino)ethoxy]-2-ethylanilino]pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[3-[[5-chloro-4-[4-[2-(dimethylamino)ethoxy]-2-ethylanilino]pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146246575 |
| Molecular Formula | C26H31ClN6O3 |
| Molecular Weight | 511.03 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | N-[3-[[5-chloro-4-[4-[2-(dimethylamino)ethoxy]-2-ethylanilino]pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(OC)c(Nc2ncc(Cl)c(Nc3ccc(OCCN(C)C)cc3CC)n2)c1 |
| InChI | InChI=1S/C26H31ClN6O3/c1-6-17-14-19(36-13-12-33(3)4)9-10-21(17)30-25-20(27)16-28-26(32-25)31-22-15-18(29-24(34)7-2)8-11-23(22)35-5/h7-11,14-16H,2,6,12-13H2,1,3-5H3,(H,29,34)(H2,28,30,31,32) |
| InChIKey | ZKMLHCXAZNZDFO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.03 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|