C30H39ClN8O6 — CID 163289080
tert-butyl N-[3-[[5-chloro-2-[4-[4-(dimethylamino)piperidin-1-yl]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]amino]-4-methoxyphenyl]carbamate (PubChem CID 163289080) has the molecular formula C30H39ClN8O6 and a molecular weight of 643.15 g/mol. Its IUPAC name is tert-butyl N-[3-[[5-chloro-2-[4-[4-(dimethylamino)piperidin-1-yl]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]amino]-4-methoxyphenyl]carbamate.
| Compound Name | tert-butyl N-[3-[[5-chloro-2-[4-[4-(dimethylamino)piperidin-1-yl]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]amino]-4-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 163289080 |
| Molecular Formula | C30H39ClN8O6 |
| Molecular Weight | 643.15 g/mol |
| Exact Mass | 642.27 |
| IUPAC Name | tert-butyl N-[3-[[5-chloro-2-[4-[4-(dimethylamino)piperidin-1-yl]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]amino]-4-methoxyphenyl]carbamate |
| SMILES | COc1cc(N2CCC(N(C)C)CC2)c([N+](=O)[O-])cc1Nc1ncc(Cl)c(Nc2cc(NC(=O)OC(C)(C)C)ccc2OC)n1 |
| InChI | InChI=1S/C30H39ClN8O6/c1-30(2,3)45-29(40)33-18-8-9-25(43-6)21(14-18)34-27-20(31)17-32-28(36-27)35-22-15-24(39(41)42)23(16-26(22)44-7)38-12-10-19(11-13-38)37(4)5/h8-9,14-17,19H,10-13H2,1-7H3,(H,33,40)(H2,32,34,35,36) |
| InChIKey | NWSJYWAKHGHDET-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 156.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.15 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|