C26H31ClFN7O4 — CID 169061722
2-[4-chloro-2-[[2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]amino]-5-fluorophenyl]propan-2-ol (PubChem CID 169061722) has the molecular formula C26H31ClFN7O4 and a molecular weight of 560.03 g/mol. Its IUPAC name is 2-[4-chloro-2-[[2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]amino]-5-fluorophenyl]propan-2-ol.
| Compound Name | 2-[4-chloro-2-[[2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]amino]-5-fluorophenyl]propan-2-ol |
|---|---|
| PubChem CID | 169061722 |
| Molecular Formula | C26H31ClFN7O4 |
| Molecular Weight | 560.03 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | 2-[4-chloro-2-[[2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]amino]-5-fluorophenyl]propan-2-ol |
| SMILES | COc1cc(N2CC[C@@H](N(C)C)C2)c([N+](=O)[O-])cc1Nc1nccc(Nc2cc(Cl)c(F)cc2C(C)(C)O)n1 |
| InChI | InChI=1S/C26H31ClFN7O4/c1-26(2,36)16-10-18(28)17(27)11-19(16)30-24-6-8-29-25(32-24)31-20-12-22(35(37)38)21(13-23(20)39-5)34-9-7-15(14-34)33(3)4/h6,8,10-13,15,36H,7,9,14H2,1-5H3,(H2,29,30,31,32)/t15-/m1/s1 |
| InChIKey | HAJYLKHLYXPFJY-OAHLLOKOSA-N |
| XLogP | 5.04 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.03 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|