C26H30F2N8O4 — CID 147832995
2-[2-[[4-[4-[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-2-methoxy-5-nitroanilino]-1,3,5-triazin-2-yl]amino]-4,5-difluorophenyl]propan-2-ol (PubChem CID 147832995) has the molecular formula C26H30F2N8O4 and a molecular weight of 556.57 g/mol. Its IUPAC name is 2-[2-[[4-[4-[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-2-methoxy-5-nitroanilino]-1,3,5-triazin-2-yl]amino]-4,5-difluorophenyl]propan-2-ol.
| Compound Name | 2-[2-[[4-[4-[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-2-methoxy-5-nitroanilino]-1,3,5-triazin-2-yl]amino]-4,5-difluorophenyl]propan-2-ol |
|---|---|
| PubChem CID | 147832995 |
| Molecular Formula | C26H30F2N8O4 |
| Molecular Weight | 556.57 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | 2-[2-[[4-[4-[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-2-methoxy-5-nitroanilino]-1,3,5-triazin-2-yl]amino]-4,5-difluorophenyl]propan-2-ol |
| SMILES | COc1cc(N2CC[C@H]3CN(C)C[C@H]32)c([N+](=O)[O-])cc1Nc1ncnc(Nc2cc(F)c(F)cc2C(C)(C)O)n1 |
| InChI | InChI=1S/C26H30F2N8O4/c1-26(2,37)15-7-16(27)17(28)8-18(15)31-24-29-13-30-25(33-24)32-19-9-21(36(38)39)20(10-23(19)40-4)35-6-5-14-11-34(3)12-22(14)35/h7-10,13-14,22,37H,5-6,11-12H2,1-4H3,(H2,29,30,31,32,33)/t14-,22+/m0/s1 |
| InChIKey | HRLSZPABUXJDDQ-RCDICMHDSA-N |
| XLogP | 3.92 |
| TPSA | 141.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.57 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|