C14H18FN3O2 — CID 124829406
(3aR,7aR)-1-(5-fluoro-2-nitrophenyl)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine (PubChem CID 124829406) has the molecular formula C14H18FN3O2 and a molecular weight of 279.31 g/mol. Its IUPAC name is (3aR,7aR)-1-(5-fluoro-2-nitrophenyl)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine.
| Compound Name | (3aR,7aR)-1-(5-fluoro-2-nitrophenyl)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 124829406 |
| Molecular Formula | C14H18FN3O2 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | (3aR,7aR)-1-(5-fluoro-2-nitrophenyl)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine |
| SMILES | CN1CC[C@@H]2CCN(c3cc(F)ccc3[N+](=O)[O-])[C@H]2C1 |
| InChI | InChI=1S/C14H18FN3O2/c1-16-6-4-10-5-7-17(14(10)9-16)13-8-11(15)2-3-12(13)18(19)20/h2-3,8,10,14H,4-7,9H2,1H3/t10-,14+/m1/s1 |
| InChIKey | XDJXMUCHBUTNLS-YGRLFVJLSA-N |
| XLogP | 2.26 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|