C13H18FN3O2 — CID 63256055
1-[1-(5-fluoro-2-nitrophenyl)piperidin-2-yl]ethanamine (PubChem CID 63256055) has the molecular formula C13H18FN3O2 and a molecular weight of 267.30 g/mol. Its IUPAC name is 1-[1-(5-fluoro-2-nitrophenyl)piperidin-2-yl]ethanamine.
| Compound Name | 1-[1-(5-fluoro-2-nitrophenyl)piperidin-2-yl]ethanamine |
|---|---|
| PubChem CID | 63256055 |
| Molecular Formula | C13H18FN3O2 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 1-[1-(5-fluoro-2-nitrophenyl)piperidin-2-yl]ethanamine |
| SMILES | CC(N)C1CCCCN1c1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18FN3O2/c1-9(15)11-4-2-3-7-16(11)13-8-10(14)5-6-12(13)17(18)19/h5-6,8-9,11H,2-4,7,15H2,1H3 |
| InChIKey | LGYLBIPGRMRCQB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|