C18H16FN3O2 — CID 133333329
2-[1-(4-fluoro-2-nitrophenyl)pyrrolidin-2-yl]-2-phenylacetonitrile (PubChem CID 133333329) has the molecular formula C18H16FN3O2 and a molecular weight of 325.34 g/mol. Its IUPAC name is 2-[1-(4-fluoro-2-nitrophenyl)pyrrolidin-2-yl]-2-phenylacetonitrile.
| Compound Name | 2-[1-(4-fluoro-2-nitrophenyl)pyrrolidin-2-yl]-2-phenylacetonitrile |
|---|---|
| PubChem CID | 133333329 |
| Molecular Formula | C18H16FN3O2 |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 2-[1-(4-fluoro-2-nitrophenyl)pyrrolidin-2-yl]-2-phenylacetonitrile |
| SMILES | N#CC(c1ccccc1)C1CCCN1c1ccc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16FN3O2/c19-14-8-9-17(18(11-14)22(23)24)21-10-4-7-16(21)15(12-20)13-5-2-1-3-6-13/h1-3,5-6,8-9,11,15-16H,4,7,10H2 |
| InChIKey | KHATUNBFUROQIO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 70.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|