C17H18N4O2S — CID 167971325
6-[2-[cyano(phenyl)methyl]pyrrolidin-1-yl]pyridine-3-sulfonamide (PubChem CID 167971325) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 6-[2-[cyano(phenyl)methyl]pyrrolidin-1-yl]pyridine-3-sulfonamide.
| Compound Name | 6-[2-[cyano(phenyl)methyl]pyrrolidin-1-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 167971325 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 6-[2-[cyano(phenyl)methyl]pyrrolidin-1-yl]pyridine-3-sulfonamide |
| SMILES | N#CC(c1ccccc1)C1CCCN1c1ccc(S(N)(=O)=O)cn1 |
| InChI | InChI=1S/C17H18N4O2S/c18-11-15(13-5-2-1-3-6-13)16-7-4-10-21(16)17-9-8-14(12-20-17)24(19,22)23/h1-3,5-6,8-9,12,15-16H,4,7,10H2,(H2,19,22,23) |
| InChIKey | GXKFCZDYWMWKQT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 100.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |