About 2-phenyl-2-[1-(4,4,4-trifluoro-2-methylbutanoyl)pyrrolidin-2-yl]acetonitrile
2-phenyl-2-[1-(4,4,4-trifluoro-2-methylbutanoyl)pyrrolidin-2-yl]acetonitrile (PubChem CID 146092317) has the molecular formula C17H19F3N2O
and a molecular weight of 324.35 g/mol. Its IUPAC name is 2-phenyl-2-[1-(4,4,4-trifluoro-2-methylbutanoyl)pyrrolidin-2-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-phenyl-2-[1-(4,4,4-trifluoro-2-methylbutanoyl)pyrrolidin-2-yl]acetonitrile |
| PubChem CID | 146092317 |
| Molecular Formula | C17H19F3N2O |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-phenyl-2-[1-(4,4,4-trifluoro-2-methylbutanoyl)pyrrolidin-2-yl]acetonitrile |
| SMILES | CC(CC(F)(F)F)C(=O)N1CCCC1C(C#N)c1ccccc1 |
| InChI | InChI=1S/C17H19F3N2O/c1-12(10-17(18,19)20)16(23)22-9-5-8-15(22)14(11-21)13-6-3-2-4-7-13/h2-4,6-7,12,14-15H,5,8-10H2,1H3 |
| InChIKey | BFUXMDKHXNCKNS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenyl-2-[1-(4,4,4-trifluoro-2-methylbutanoyl)pyrrolidin-2-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-2-[1-(4,4,4-trifluoro-2-methylbutanoyl)pyrrolidin-2-yl]acetonitrile?
The IUPAC name of 2-phenyl-2-[1-(4,4,4-trifluoro-2-methylbutanoyl)pyrrolidin-2-yl]acetonitrile (CID 146092317) is 2-phenyl-2-[1-(4,4,4-trifluoro-2-methylbutanoyl)pyrrolidin-2-yl]acetonitrile.
What is the SMILES notation for 2-phenyl-2-[1-(4,4,4-trifluoro-2-methylbutanoyl)pyrrolidin-2-yl]acetonitrile?
The canonical SMILES for 2-phenyl-2-[1-(4,4,4-trifluoro-2-methylbutanoyl)pyrrolidin-2-yl]acetonitrile is CC(CC(F)(F)F)C(=O)N1CCCC1C(C#N)c1ccccc1.
What is the InChIKey of 2-phenyl-2-[1-(4,4,4-trifluoro-2-methylbutanoyl)pyrrolidin-2-yl]acetonitrile?
The InChIKey is BFUXMDKHXNCKNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19F3N2O/c1-12(10-17(18,19)20)16(23)22-9-5-8-15(22)14(11-21)13-6-3-2-4-7-13/h2-4,6-7,12,14-15H,5,8-10H2,1H3.
What are the key properties of 2-phenyl-2-[1-(4,4,4-trifluoro-2-methylbutanoyl)pyrrolidin-2-yl]acetonitrile?
2-phenyl-2-[1-(4,4,4-trifluoro-2-methylbutanoyl)pyrrolidin-2-yl]acetonitrile has a molecular weight of 324.35 g/mol, XLogP of 3.87, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-2-[1-(4,4,4-trifluoro-2-methylbutanoyl)pyrrolidin-2-yl]acetonitrile is sourced from PubChem (CID 146092317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).