C16H20N4O3S — CID 167752090
2-[3-[hydroxy(phenyl)methyl]piperidin-1-yl]pyrimidine-5-sulfonamide (PubChem CID 167752090) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is 2-[3-[hydroxy(phenyl)methyl]piperidin-1-yl]pyrimidine-5-sulfonamide.
| Compound Name | 2-[3-[hydroxy(phenyl)methyl]piperidin-1-yl]pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 167752090 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 2-[3-[hydroxy(phenyl)methyl]piperidin-1-yl]pyrimidine-5-sulfonamide |
| SMILES | NS(=O)(=O)c1cnc(N2CCCC(C(O)c3ccccc3)C2)nc1 |
| InChI | InChI=1S/C16H20N4O3S/c17-24(22,23)14-9-18-16(19-10-14)20-8-4-7-13(11-20)15(21)12-5-2-1-3-6-12/h1-3,5-6,9-10,13,15,21H,4,7-8,11H2,(H2,17,22,23) |
| InChIKey | WKHZUEUMFDRMJI-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |