C19H24N4O — CID 142638878
phenyl-(2-pyrimidin-2-yl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl)methanol (PubChem CID 142638878) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is phenyl-(2-pyrimidin-2-yl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl)methanol.
| Compound Name | phenyl-(2-pyrimidin-2-yl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl)methanol |
|---|---|
| PubChem CID | 142638878 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | phenyl-(2-pyrimidin-2-yl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl)methanol |
| SMILES | OC(c1ccccc1)C1CCC2CN(c3ncccn3)CCN2C1 |
| InChI | InChI=1S/C19H24N4O/c24-18(15-5-2-1-3-6-15)16-7-8-17-14-23(12-11-22(17)13-16)19-20-9-4-10-21-19/h1-6,9-10,16-18,24H,7-8,11-14H2 |
| InChIKey | SBHMTHFCSDFZNO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |