C14H22N4OS — CID 86285738
1-pyrimidin-2-yl-4-(thian-4-yl)-1,4-diazepan-6-ol (PubChem CID 86285738) has the molecular formula C14H22N4OS and a molecular weight of 294.42 g/mol. Its IUPAC name is 1-pyrimidin-2-yl-4-(thian-4-yl)-1,4-diazepan-6-ol.
| Compound Name | 1-pyrimidin-2-yl-4-(thian-4-yl)-1,4-diazepan-6-ol |
|---|---|
| PubChem CID | 86285738 |
| Molecular Formula | C14H22N4OS |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 1-pyrimidin-2-yl-4-(thian-4-yl)-1,4-diazepan-6-ol |
| SMILES | OC1CN(c2ncccn2)CCN(C2CCSCC2)C1 |
| InChI | InChI=1S/C14H22N4OS/c19-13-10-17(12-2-8-20-9-3-12)6-7-18(11-13)14-15-4-1-5-16-14/h1,4-5,12-13,19H,2-3,6-11H2 |
| InChIKey | CWCLWVFWFMECFS-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |