C16H26N4 — CID 5143216
2-[4-(4-ethylcyclohexyl)piperazin-1-yl]pyrimidine (PubChem CID 5143216) has the molecular formula C16H26N4 and a molecular weight of 274.41 g/mol. Its IUPAC name is 2-[4-(4-ethylcyclohexyl)piperazin-1-yl]pyrimidine.
| Compound Name | 2-[4-(4-ethylcyclohexyl)piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 5143216 |
| Molecular Formula | C16H26N4 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | 2-[4-(4-ethylcyclohexyl)piperazin-1-yl]pyrimidine |
| SMILES | CCC1CCC(N2CCN(c3ncccn3)CC2)CC1 |
| InChI | InChI=1S/C16H26N4/c1-2-14-4-6-15(7-5-14)19-10-12-20(13-11-19)16-17-8-3-9-18-16/h3,8-9,14-15H,2,4-7,10-13H2,1H3 |
| InChIKey | WYMVOPBKSKYGJU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |