C19H29N3O2 — CID 22492996
methyl 6-[4-(4-ethylcyclohexyl)piperazin-1-yl]pyridine-3-carboxylate (PubChem CID 22492996) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is methyl 6-[4-(4-ethylcyclohexyl)piperazin-1-yl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[4-(4-ethylcyclohexyl)piperazin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 22492996 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | methyl 6-[4-(4-ethylcyclohexyl)piperazin-1-yl]pyridine-3-carboxylate |
| SMILES | CCC1CCC(N2CCN(c3ccc(C(=O)OC)cn3)CC2)CC1 |
| InChI | InChI=1S/C19H29N3O2/c1-3-15-4-7-17(8-5-15)21-10-12-22(13-11-21)18-9-6-16(14-20-18)19(23)24-2/h6,9,14-15,17H,3-5,7-8,10-13H2,1-2H3 |
| InChIKey | GNWWQSOBKIQEMC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |