C22H27N3O3 — CID 134414344
benzyl 6-[7-(hydroxymethyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]pyridine-3-carboxylate (PubChem CID 134414344) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is benzyl 6-[7-(hydroxymethyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]pyridine-3-carboxylate.
| Compound Name | benzyl 6-[7-(hydroxymethyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134414344 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | benzyl 6-[7-(hydroxymethyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]pyridine-3-carboxylate |
| SMILES | O=C(OCc1ccccc1)c1ccc(N2CCN3CC(CO)CCC3C2)nc1 |
| InChI | InChI=1S/C22H27N3O3/c26-15-18-6-8-20-14-25(11-10-24(20)13-18)21-9-7-19(12-23-21)22(27)28-16-17-4-2-1-3-5-17/h1-5,7,9,12,18,20,26H,6,8,10-11,13-16H2 |
| InChIKey | LBBHHTRCQQVUOS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |