C26H27N5O3 — CID 16663009
benzyl (1S,5R)-3-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 16663009) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is benzyl (1S,5R)-3-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | benzyl (1S,5R)-3-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 16663009 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | benzyl (1S,5R)-3-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | Nc1ccccc1NC(=O)c1ccc(N2C[C@H]3CC[C@@H](C2)N3C(=O)OCc2ccccc2)nc1 |
| InChI | InChI=1S/C26H27N5O3/c27-22-8-4-5-9-23(22)29-25(32)19-10-13-24(28-14-19)30-15-20-11-12-21(16-30)31(20)26(33)34-17-18-6-2-1-3-7-18/h1-10,13-14,20-21H,11-12,15-17,27H2,(H,29,32)/t20-,21+ |
| InChIKey | JSIUIABSNRSYTH-OYRHEFFESA-N |
| XLogP | 3.91 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|