C18H23N5O — CID 69085241
N-(2-aminophenyl)-6-(3,5-dimethylpiperazin-1-yl)pyridine-3-carboxamide (PubChem CID 69085241) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is N-(2-aminophenyl)-6-(3,5-dimethylpiperazin-1-yl)pyridine-3-carboxamide.
| Compound Name | N-(2-aminophenyl)-6-(3,5-dimethylpiperazin-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 69085241 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | N-(2-aminophenyl)-6-(3,5-dimethylpiperazin-1-yl)pyridine-3-carboxamide |
| SMILES | CC1CN(c2ccc(C(=O)Nc3ccccc3N)cn2)CC(C)N1 |
| InChI | InChI=1S/C18H23N5O/c1-12-10-23(11-13(2)21-12)17-8-7-14(9-20-17)18(24)22-16-6-4-3-5-15(16)19/h3-9,12-13,21H,10-11,19H2,1-2H3,(H,22,24) |
| InChIKey | HKZPHZQYERFYSY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|