C21H25N5O3 — CID 68900468
2-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-2,8-diazaspiro[4.5]decane-8-carboxylic acid (PubChem CID 68900468) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-2,8-diazaspiro[4.5]decane-8-carboxylic acid.
| Compound Name | 2-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-2,8-diazaspiro[4.5]decane-8-carboxylic acid |
|---|---|
| PubChem CID | 68900468 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 2-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-2,8-diazaspiro[4.5]decane-8-carboxylic acid |
| SMILES | Nc1ccccc1NC(=O)c1ccc(N2CCC3(CCN(C(=O)O)CC3)C2)nc1 |
| InChI | InChI=1S/C21H25N5O3/c22-16-3-1-2-4-17(16)24-19(27)15-5-6-18(23-13-15)26-12-9-21(14-26)7-10-25(11-8-21)20(28)29/h1-6,13H,7-12,14,22H2,(H,24,27)(H,28,29) |
| InChIKey | MZTHZFWGDYXRCV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|