C29H34N6O2 — CID 24744160
9-[5-[(2-amino-5-phenylphenyl)carbamoyl]-2-pyridinyl]-N-ethyl-2,9-diazaspiro[4.5]decane-2-carboxamide (PubChem CID 24744160) has the molecular formula C29H34N6O2 and a molecular weight of 498.63 g/mol. Its IUPAC name is 9-[5-[(2-amino-5-phenylphenyl)carbamoyl]-2-pyridinyl]-N-ethyl-2,9-diazaspiro[4.5]decane-2-carboxamide.
| Compound Name | 9-[5-[(2-amino-5-phenylphenyl)carbamoyl]-2-pyridinyl]-N-ethyl-2,9-diazaspiro[4.5]decane-2-carboxamide |
|---|---|
| PubChem CID | 24744160 |
| Molecular Formula | C29H34N6O2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 9-[5-[(2-amino-5-phenylphenyl)carbamoyl]-2-pyridinyl]-N-ethyl-2,9-diazaspiro[4.5]decane-2-carboxamide |
| SMILES | CCNC(=O)N1CCC2(CCCN(c3ccc(C(=O)Nc4cc(-c5ccccc5)ccc4N)cn3)C2)C1 |
| InChI | InChI=1S/C29H34N6O2/c1-2-31-28(37)35-16-14-29(20-35)13-6-15-34(19-29)26-12-10-23(18-32-26)27(36)33-25-17-22(9-11-24(25)30)21-7-4-3-5-8-21/h3-5,7-12,17-18H,2,6,13-16,19-20,30H2,1H3,(H,31,37)(H,33,36) |
| InChIKey | VFLXUEFJURLETQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|